C33H23F5O5S3 — CID 139989829
[[4-(2-benzoylphenyl)sulfanylphenyl]-(4-methoxyphenyl)-(2,3,4,5,6-pentafluorophenyl)-λ4-sulfanyl] methanesulfonate (PubChem CID 139989829) has the molecular formula C33H23F5O5S3 and a molecular weight of 690.73 g/mol. Its IUPAC name is [[4-(2-benzoylphenyl)sulfanylphenyl]-(4-methoxyphenyl)-(2,3,4,5,6-pentafluorophenyl)-λ4-sulfanyl] methanesulfonate.
| Compound Name | [[4-(2-benzoylphenyl)sulfanylphenyl]-(4-methoxyphenyl)-(2,3,4,5,6-pentafluorophenyl)-λ4-sulfanyl] methanesulfonate |
|---|---|
| PubChem CID | 139989829 |
| Molecular Formula | C33H23F5O5S3 |
| Molecular Weight | 690.73 g/mol |
| Exact Mass | 690.06 |
| IUPAC Name | [[4-(2-benzoylphenyl)sulfanylphenyl]-(4-methoxyphenyl)-(2,3,4,5,6-pentafluorophenyl)-λ4-sulfanyl] methanesulfonate |
| SMILES | COc1ccc(S(OS(C)(=O)=O)(c2ccc(Sc3ccccc3C(=O)c3ccccc3)cc2)c2c(F)c(F)c(F)c(F)c2F)cc1 |
| InChI | InChI=1S/C33H23F5O5S3/c1-42-21-12-16-23(17-13-21)46(43-45(2,40)41,33-30(37)28(35)27(34)29(36)31(33)38)24-18-14-22(15-19-24)44-26-11-7-6-10-25(26)32(39)20-8-4-3-5-9-20/h3-19H,1-2H3 |
| InChIKey | BEUQYBBXIKTIHH-UHFFFAOYSA-N |
| XLogP | 8.95 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 690.73 |
| LogP ≤ 5 | 8.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|