C22H24N10O2 — CID 139995577
6-[2-[2-[2-[2-(4,6-diamino-1,3,5-triazin-2-yl)ethoxy]phenyl]phenoxy]ethyl]-1,3,5-triazine-2,4-diamine (PubChem CID 139995577) has the molecular formula C22H24N10O2 and a molecular weight of 460.50 g/mol. Its IUPAC name is 6-[2-[2-[2-[2-(4,6-diamino-1,3,5-triazin-2-yl)ethoxy]phenyl]phenoxy]ethyl]-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-[2-[2-[2-[2-(4,6-diamino-1,3,5-triazin-2-yl)ethoxy]phenyl]phenoxy]ethyl]-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 139995577 |
| Molecular Formula | C22H24N10O2 |
| Molecular Weight | 460.50 g/mol |
| Exact Mass | 460.21 |
| IUPAC Name | 6-[2-[2-[2-[2-(4,6-diamino-1,3,5-triazin-2-yl)ethoxy]phenyl]phenoxy]ethyl]-1,3,5-triazine-2,4-diamine |
| SMILES | Nc1nc(N)nc(CCOc2ccccc2-c2ccccc2OCCc2nc(N)nc(N)n2)n1 |
| InChI | InChI=1S/C22H24N10O2/c23-19-27-17(28-20(24)31-19)9-11-33-15-7-3-1-5-13(15)14-6-2-4-8-16(14)34-12-10-18-29-21(25)32-22(26)30-18/h1-8H,9-12H2,(H4,23,24,27,28,31)(H4,25,26,29,30,32) |
| InChIKey | CBIHSIQOTKUQLJ-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 199.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.50 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |