C11H19NO4 — CID 139997641
butyl 4-formyl-2,2-dimethyl-1,3-oxazolidine-3-carboxylate (PubChem CID 139997641) has the molecular formula C11H19NO4 and a molecular weight of 229.28 g/mol. Its IUPAC name is butyl 4-formyl-2,2-dimethyl-1,3-oxazolidine-3-carboxylate.
| Compound Name | butyl 4-formyl-2,2-dimethyl-1,3-oxazolidine-3-carboxylate |
|---|---|
| PubChem CID | 139997641 |
| Molecular Formula | C11H19NO4 |
| Molecular Weight | 229.28 g/mol |
| Exact Mass | 229.13 |
| IUPAC Name | butyl 4-formyl-2,2-dimethyl-1,3-oxazolidine-3-carboxylate |
| SMILES | CCCCOC(=O)N1C(C=O)COC1(C)C |
| InChI | InChI=1S/C11H19NO4/c1-4-5-6-15-10(14)12-9(7-13)8-16-11(12,2)3/h7,9H,4-6,8H2,1-3H3 |
| InChIKey | GMQMIDWYANCIPE-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.28 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|