C11H21N3O4 — CID 139999133
(2S)-1-(2-amino-2-oxoethyl)-5,5-diethoxypyrrolidine-2-carboxamide (PubChem CID 139999133) has the molecular formula C11H21N3O4 and a molecular weight of 259.31 g/mol. Its IUPAC name is (2S)-1-(2-amino-2-oxoethyl)-5,5-diethoxypyrrolidine-2-carboxamide.
| Compound Name | (2S)-1-(2-amino-2-oxoethyl)-5,5-diethoxypyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 139999133 |
| Molecular Formula | C11H21N3O4 |
| Molecular Weight | 259.31 g/mol |
| Exact Mass | 259.15 |
| IUPAC Name | (2S)-1-(2-amino-2-oxoethyl)-5,5-diethoxypyrrolidine-2-carboxamide |
| SMILES | CCOC1(OCC)CC[C@@H](C(N)=O)N1CC(N)=O |
| InChI | InChI=1S/C11H21N3O4/c1-3-17-11(18-4-2)6-5-8(10(13)16)14(11)7-9(12)15/h8H,3-7H2,1-2H3,(H2,12,15)(H2,13,16)/t8-/m0/s1 |
| InChIKey | PPKFPADHPGKOGD-QMMMGPOBSA-N |
| XLogP | -0.85 |
| TPSA | 107.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.31 |
| LogP ≤ 5 | -0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|