C28H30N2O4 — CID 14003929
3,6-bis(3,4-dimethoxyphenyl)-4,5-dimethyl-1-phenyl-4H-pyridazine (PubChem CID 14003929) has the molecular formula C28H30N2O4 and a molecular weight of 458.56 g/mol. Its IUPAC name is 3,6-bis(3,4-dimethoxyphenyl)-4,5-dimethyl-1-phenyl-4H-pyridazine.
| Compound Name | 3,6-bis(3,4-dimethoxyphenyl)-4,5-dimethyl-1-phenyl-4H-pyridazine |
|---|---|
| PubChem CID | 14003929 |
| Molecular Formula | C28H30N2O4 |
| Molecular Weight | 458.56 g/mol |
| Exact Mass | 458.22 |
| IUPAC Name | 3,6-bis(3,4-dimethoxyphenyl)-4,5-dimethyl-1-phenyl-4H-pyridazine |
| SMILES | COc1ccc(C2=NN(c3ccccc3)C(c3ccc(OC)c(OC)c3)=C(C)C2C)cc1OC |
| InChI | InChI=1S/C28H30N2O4/c1-18-19(2)28(21-13-15-24(32-4)26(17-21)34-6)30(22-10-8-7-9-11-22)29-27(18)20-12-14-23(31-3)25(16-20)33-5/h7-18H,1-6H3 |
| InChIKey | TVRFHBOWMVZYFE-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 52.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.56 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |