About ethyl 2-(2-hydroxy-4,4-dimethyl-6-oxocyclohexen-1-yl)acetate
ethyl 2-(2-hydroxy-4,4-dimethyl-6-oxocyclohexen-1-yl)acetate (PubChem CID 14026422) has the molecular formula C12H18O4
and a molecular weight of 226.27 g/mol. Its IUPAC name is ethyl 2-(2-hydroxy-4,4-dimethyl-6-oxocyclohexen-1-yl)acetate.
Analyze ethyl 2-(2-hydroxy-4,4-dimethyl-6-oxocyclohexen-1-yl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-(2-hydroxy-4,4-dimethyl-6-oxocyclohexen-1-yl)acetate?
The IUPAC name of ethyl 2-(2-hydroxy-4,4-dimethyl-6-oxocyclohexen-1-yl)acetate (CID 14026422) is ethyl 2-(2-hydroxy-4,4-dimethyl-6-oxocyclohexen-1-yl)acetate.
What is the SMILES notation for ethyl 2-(2-hydroxy-4,4-dimethyl-6-oxocyclohexen-1-yl)acetate?
The canonical SMILES for ethyl 2-(2-hydroxy-4,4-dimethyl-6-oxocyclohexen-1-yl)acetate is CCOC(=O)CC1=C(O)CC(C)(C)CC1=O.
What is the InChIKey of ethyl 2-(2-hydroxy-4,4-dimethyl-6-oxocyclohexen-1-yl)acetate?
The InChIKey is KHKIRORUCVHKLY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18O4/c1-4-16-11(15)5-8-9(13)6-12(2,3)7-10(8)14/h13H,4-7H2,1-3H3.
What are the key properties of ethyl 2-(2-hydroxy-4,4-dimethyl-6-oxocyclohexen-1-yl)acetate?
ethyl 2-(2-hydroxy-4,4-dimethyl-6-oxocyclohexen-1-yl)acetate has a molecular weight of 226.27 g/mol, XLogP of 2.14, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-(2-hydroxy-4,4-dimethyl-6-oxocyclohexen-1-yl)acetate is sourced from PubChem (CID 14026422), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).