C19H25ClN6S2 — CID 1402701
[4-amino-6-(3-chloro-2-methylanilino)-1,3,5-triazin-2-yl]methyl N-cyclohexyl-N-methylcarbamodithioate (PubChem CID 1402701) has the molecular formula C19H25ClN6S2 and a molecular weight of 437.04 g/mol. Its IUPAC name is [4-amino-6-(3-chloro-2-methylanilino)-1,3,5-triazin-2-yl]methyl N-cyclohexyl-N-methylcarbamodithioate.
| Compound Name | [4-amino-6-(3-chloro-2-methylanilino)-1,3,5-triazin-2-yl]methyl N-cyclohexyl-N-methylcarbamodithioate |
|---|---|
| PubChem CID | 1402701 |
| Molecular Formula | C19H25ClN6S2 |
| Molecular Weight | 437.04 g/mol |
| Exact Mass | 436.13 |
| IUPAC Name | [4-amino-6-(3-chloro-2-methylanilino)-1,3,5-triazin-2-yl]methyl N-cyclohexyl-N-methylcarbamodithioate |
| SMILES | Cc1c(Cl)cccc1Nc1nc(N)nc(CSC(=S)N(C)C2CCCCC2)n1 |
| InChI | InChI=1S/C19H25ClN6S2/c1-12-14(20)9-6-10-15(12)22-18-24-16(23-17(21)25-18)11-28-19(27)26(2)13-7-4-3-5-8-13/h6,9-10,13H,3-5,7-8,11H2,1-2H3,(H3,21,22,23,24,25) |
| InChIKey | MGDMUYQFLIVPFF-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 79.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.04 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|