C18H23ClN6OS2 — CID 3408055
[4-amino-6-(5-chloro-2-methoxyanilino)-1,3,5-triazin-2-yl]methyl 2-methylpiperidine-1-carbodithioate (PubChem CID 3408055) has the molecular formula C18H23ClN6OS2 and a molecular weight of 439.01 g/mol. Its IUPAC name is [4-amino-6-(5-chloro-2-methoxyanilino)-1,3,5-triazin-2-yl]methyl 2-methylpiperidine-1-carbodithioate.
| Compound Name | [4-amino-6-(5-chloro-2-methoxyanilino)-1,3,5-triazin-2-yl]methyl 2-methylpiperidine-1-carbodithioate |
|---|---|
| PubChem CID | 3408055 |
| Molecular Formula | C18H23ClN6OS2 |
| Molecular Weight | 439.01 g/mol |
| Exact Mass | 438.11 |
| IUPAC Name | [4-amino-6-(5-chloro-2-methoxyanilino)-1,3,5-triazin-2-yl]methyl 2-methylpiperidine-1-carbodithioate |
| SMILES | COc1ccc(Cl)cc1Nc1nc(N)nc(CSC(=S)N2CCCCC2C)n1 |
| InChI | InChI=1S/C18H23ClN6OS2/c1-11-5-3-4-8-25(11)18(27)28-10-15-22-16(20)24-17(23-15)21-13-9-12(19)6-7-14(13)26-2/h6-7,9,11H,3-5,8,10H2,1-2H3,(H3,20,21,22,23,24) |
| InChIKey | PXHJYSYQTXSUKJ-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 89.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.01 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|