C12H15F9 — CID 14043465
(E)-1,1,1,2,2,3,3,4,4-nonafluorododec-5-ene (PubChem CID 14043465) has the molecular formula C12H15F9 and a molecular weight of 330.23 g/mol. Its IUPAC name is (E)-1,1,1,2,2,3,3,4,4-nonafluorododec-5-ene.
| Compound Name | (E)-1,1,1,2,2,3,3,4,4-nonafluorododec-5-ene |
|---|---|
| PubChem CID | 14043465 |
| Molecular Formula | C12H15F9 |
| Molecular Weight | 330.23 g/mol |
| Exact Mass | 330.10 |
| IUPAC Name | (E)-1,1,1,2,2,3,3,4,4-nonafluorododec-5-ene |
| SMILES | CCCCCC/C=C/C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C12H15F9/c1-2-3-4-5-6-7-8-9(13,14)10(15,16)11(17,18)12(19,20)21/h7-8H,2-6H2,1H3/b8-7+ |
| InChIKey | IICPDVVTTGLPAT-BQYQJAHWSA-N |
| XLogP | 5.98 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.23 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|