C32H32Cl2N6O2S — CID 140502490
5-[(2,5-dichloro-4-methylsulfonylphenyl)diazenyl]-4-methyl-2,6-bis(2,4,6-trimethylanilino)pyridine-3-carbonitrile (PubChem CID 140502490) has the molecular formula C32H32Cl2N6O2S and a molecular weight of 635.62 g/mol. Its IUPAC name is 5-[(2,5-dichloro-4-methylsulfonylphenyl)diazenyl]-4-methyl-2,6-bis(2,4,6-trimethylanilino)pyridine-3-carbonitrile.
| Compound Name | 5-[(2,5-dichloro-4-methylsulfonylphenyl)diazenyl]-4-methyl-2,6-bis(2,4,6-trimethylanilino)pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 140502490 |
| Molecular Formula | C32H32Cl2N6O2S |
| Molecular Weight | 635.62 g/mol |
| Exact Mass | 634.17 |
| IUPAC Name | 5-[(2,5-dichloro-4-methylsulfonylphenyl)diazenyl]-4-methyl-2,6-bis(2,4,6-trimethylanilino)pyridine-3-carbonitrile |
| SMILES | Cc1cc(C)c(Nc2nc(Nc3c(C)cc(C)cc3C)c(/N=N/c3cc(Cl)c(S(C)(=O)=O)cc3Cl)c(C)c2C#N)c(C)c1 |
| InChI | InChI=1S/C32H32Cl2N6O2S/c1-16-9-18(3)28(19(4)10-16)36-31-23(15-35)22(7)30(32(38-31)37-29-20(5)11-17(2)12-21(29)6)40-39-26-13-25(34)27(14-24(26)33)43(8,41)42/h9-14H,1-8H3,(H2,36,37,38)/b40-39+ |
| InChIKey | RIGKVQPITWWUEB-XQQUEIPISA-N |
| XLogP | 9.73 |
| TPSA | 119.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.62 |
| LogP ≤ 5 | 9.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|