C9H4O7S — CID 140508999
6-hydroxy-3,3-dioxo-2,4,8-trioxa-3λ6-thiatricyclo[7.3.1.05,13]trideca-1(12),5,9(13),10-tetraen-7-one (PubChem CID 140508999) has the molecular formula C9H4O7S and a molecular weight of 256.19 g/mol. Its IUPAC name is 6-hydroxy-3,3-dioxo-2,4,8-trioxa-3λ6-thiatricyclo[7.3.1.05,13]trideca-1(12),5,9(13),10-tetraen-7-one.
| Compound Name | 6-hydroxy-3,3-dioxo-2,4,8-trioxa-3λ6-thiatricyclo[7.3.1.05,13]trideca-1(12),5,9(13),10-tetraen-7-one |
|---|---|
| PubChem CID | 140508999 |
| Molecular Formula | C9H4O7S |
| Molecular Weight | 256.19 g/mol |
| Exact Mass | 255.97 |
| IUPAC Name | 6-hydroxy-3,3-dioxo-2,4,8-trioxa-3λ6-thiatricyclo[7.3.1.05,13]trideca-1(12),5,9(13),10-tetraen-7-one |
| SMILES | O=c1oc2cccc3c2c(c1O)OS(=O)(=O)O3 |
| InChI | InChI=1S/C9H4O7S/c10-7-8-6-4(14-9(7)11)2-1-3-5(6)15-17(12,13)16-8/h1-3,10H |
| InChIKey | YLAGEXIDDUGIKM-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 103.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.19 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|