C8H12N2O4S — CID 140510937
3-acetamido-1-aminocyclohexa-2,4-diene-1-sulfonic acid (PubChem CID 140510937) has the molecular formula C8H12N2O4S and a molecular weight of 232.26 g/mol. Its IUPAC name is 3-acetamido-1-aminocyclohexa-2,4-diene-1-sulfonic acid.
| Compound Name | 3-acetamido-1-aminocyclohexa-2,4-diene-1-sulfonic acid |
|---|---|
| PubChem CID | 140510937 |
| Molecular Formula | C8H12N2O4S |
| Molecular Weight | 232.26 g/mol |
| Exact Mass | 232.05 |
| IUPAC Name | 3-acetamido-1-aminocyclohexa-2,4-diene-1-sulfonic acid |
| SMILES | CC(=O)NC1=CC(N)(S(=O)(=O)O)CC=C1 |
| InChI | InChI=1S/C8H12N2O4S/c1-6(11)10-7-3-2-4-8(9,5-7)15(12,13)14/h2-3,5H,4,9H2,1H3,(H,10,11)(H,12,13,14) |
| InChIKey | CZJQONIXWBKRJP-UHFFFAOYSA-N |
| XLogP | -0.49 |
| TPSA | 109.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.26 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|