C51H34F6O5S — CID 140512590
[phenyl-bis[4-(trifluoromethyl)phenyl]-λ4-sulfanyl] 3,4,5-triphenoxy-2-phenylbenzoate (PubChem CID 140512590) has the molecular formula C51H34F6O5S and a molecular weight of 872.88 g/mol. Its IUPAC name is [phenyl-bis[4-(trifluoromethyl)phenyl]-λ4-sulfanyl] 3,4,5-triphenoxy-2-phenylbenzoate.
| Compound Name | [phenyl-bis[4-(trifluoromethyl)phenyl]-λ4-sulfanyl] 3,4,5-triphenoxy-2-phenylbenzoate |
|---|---|
| PubChem CID | 140512590 |
| Molecular Formula | C51H34F6O5S |
| Molecular Weight | 872.88 g/mol |
| Exact Mass | 872.20 |
| IUPAC Name | [phenyl-bis[4-(trifluoromethyl)phenyl]-λ4-sulfanyl] 3,4,5-triphenoxy-2-phenylbenzoate |
| SMILES | O=C(OS(c1ccccc1)(c1ccc(C(F)(F)F)cc1)c1ccc(C(F)(F)F)cc1)c1cc(Oc2ccccc2)c(Oc2ccccc2)c(Oc2ccccc2)c1-c1ccccc1 |
| InChI | InChI=1S/C51H34F6O5S/c52-50(53,54)36-26-30-42(31-27-36)63(41-24-14-5-15-25-41,43-32-28-37(29-33-43)51(55,56)57)62-49(58)44-34-45(59-38-18-8-2-9-19-38)47(60-39-20-10-3-11-21-39)48(61-40-22-12-4-13-23-40)46(44)35-16-6-1-7-17-35/h1-34H |
| InChIKey | HCQNZBOGFGKOKV-UHFFFAOYSA-N |
| XLogP | 15.82 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 872.88 |
| LogP ≤ 5 | 15.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |