C12H27NO — CID 140513463
(1,4,4-triethylcyclohexyl)azanium hydroxide (PubChem CID 140513463) has the molecular formula C12H27NO and a molecular weight of 201.35 g/mol. Its IUPAC name is (1,4,4-triethylcyclohexyl)azanium hydroxide.
| Compound Name | (1,4,4-triethylcyclohexyl)azanium hydroxide |
|---|---|
| PubChem CID | 140513463 |
| Molecular Formula | C12H27NO |
| Molecular Weight | 201.35 g/mol |
| Exact Mass | 201.21 |
| IUPAC Name | (1,4,4-triethylcyclohexyl)azanium hydroxide |
| SMILES | CCC1([NH3+])CCC(CC)(CC)CC1.[OH-] |
| InChI | InChI=1S/C12H25N.H2O/c1-4-11(5-2)7-9-12(13,6-3)10-8-11;/h4-10,13H2,1-3H3;1H2 |
| InChIKey | FOHUTYPHJAOTQJ-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 57.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.35 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |