C25H32F2O6S2 — CID 140513491
1-adamantylmethyl 2,2-difluoro-2-(1-phenacylthiolan-1-yl)oxysulfonylacetate (PubChem CID 140513491) has the molecular formula C25H32F2O6S2 and a molecular weight of 530.66 g/mol. Its IUPAC name is 1-adamantylmethyl 2,2-difluoro-2-(1-phenacylthiolan-1-yl)oxysulfonylacetate.
| Compound Name | 1-adamantylmethyl 2,2-difluoro-2-(1-phenacylthiolan-1-yl)oxysulfonylacetate |
|---|---|
| PubChem CID | 140513491 |
| Molecular Formula | C25H32F2O6S2 |
| Molecular Weight | 530.66 g/mol |
| Exact Mass | 530.16 |
| IUPAC Name | 1-adamantylmethyl 2,2-difluoro-2-(1-phenacylthiolan-1-yl)oxysulfonylacetate |
| SMILES | O=C(CS1(OS(=O)(=O)C(F)(F)C(=O)OCC23CC4CC(CC(C4)C2)C3)CCCC1)c1ccccc1 |
| InChI | InChI=1S/C25H32F2O6S2/c26-25(27,23(29)32-17-24-13-18-10-19(14-24)12-20(11-18)15-24)35(30,31)33-34(8-4-5-9-34)16-22(28)21-6-2-1-3-7-21/h1-3,6-7,18-20H,4-5,8-17H2 |
| InChIKey | QBXLVIJTLNRNKY-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.66 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |