C25H32F2O7S2 — CID 140515612
2-(1-adamantyl)propan-2-yl 3-[4-(2,2-difluoro-2-methoxyperoxysulfanylacetyl)oxyphenyl]sulfanylpropanoate (PubChem CID 140515612) has the molecular formula C25H32F2O7S2 and a molecular weight of 546.65 g/mol. Its IUPAC name is 2-(1-adamantyl)propan-2-yl 3-[4-(2,2-difluoro-2-methoxyperoxysulfanylacetyl)oxyphenyl]sulfanylpropanoate.
| Compound Name | 2-(1-adamantyl)propan-2-yl 3-[4-(2,2-difluoro-2-methoxyperoxysulfanylacetyl)oxyphenyl]sulfanylpropanoate |
|---|---|
| PubChem CID | 140515612 |
| Molecular Formula | C25H32F2O7S2 |
| Molecular Weight | 546.65 g/mol |
| Exact Mass | 546.16 |
| IUPAC Name | 2-(1-adamantyl)propan-2-yl 3-[4-(2,2-difluoro-2-methoxyperoxysulfanylacetyl)oxyphenyl]sulfanylpropanoate |
| SMILES | COOOSC(F)(F)C(=O)Oc1ccc(SCCC(=O)OC(C)(C)C23CC4CC(CC(C4)C2)C3)cc1 |
| InChI | InChI=1S/C25H32F2O7S2/c1-23(2,24-13-16-10-17(14-24)12-18(11-16)15-24)32-21(28)8-9-35-20-6-4-19(5-7-20)31-22(29)25(26,27)36-34-33-30-3/h4-7,16-18H,8-15H2,1-3H3 |
| InChIKey | QFUCXDQJVPKZEI-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.65 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|