C15H21N5O4 — CID 140516883
[4-[(4-acetylpiperazin-1-yl)methyl]-N-carbamimidoylanilino] hydrogen carbonate (PubChem CID 140516883) has the molecular formula C15H21N5O4 and a molecular weight of 335.36 g/mol. Its IUPAC name is [4-[(4-acetylpiperazin-1-yl)methyl]-N-carbamimidoylanilino] hydrogen carbonate.
| Compound Name | [4-[(4-acetylpiperazin-1-yl)methyl]-N-carbamimidoylanilino] hydrogen carbonate |
|---|---|
| PubChem CID | 140516883 |
| Molecular Formula | C15H21N5O4 |
| Molecular Weight | 335.36 g/mol |
| Exact Mass | 335.16 |
| IUPAC Name | [4-[(4-acetylpiperazin-1-yl)methyl]-N-carbamimidoylanilino] hydrogen carbonate |
| SMILES | [H]/N=C(\N)N(OC(=O)O)c1ccc(CN2CCN(C(C)=O)CC2)cc1 |
| InChI | InChI=1S/C15H21N5O4/c1-11(21)19-8-6-18(7-9-19)10-12-2-4-13(5-3-12)20(14(16)17)24-15(22)23/h2-5H,6-10H2,1H3,(H3,16,17)(H,22,23) |
| InChIKey | LXQOMNKMUNMAIT-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 123.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.36 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|