C16HF21O2 — CID 140518745
2,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-hexadecafluoro-1-(2,3,4,5,6-pentafluorophenyl)decane-1,3-dione (PubChem CID 140518745) has the molecular formula C16HF21O2 and a molecular weight of 624.14 g/mol. Its IUPAC name is 2,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-hexadecafluoro-1-(2,3,4,5,6-pentafluorophenyl)decane-1,3-dione.
| Compound Name | 2,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-hexadecafluoro-1-(2,3,4,5,6-pentafluorophenyl)decane-1,3-dione |
|---|---|
| PubChem CID | 140518745 |
| Molecular Formula | C16HF21O2 |
| Molecular Weight | 624.14 g/mol |
| Exact Mass | 623.96 |
| IUPAC Name | 2,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-hexadecafluoro-1-(2,3,4,5,6-pentafluorophenyl)decane-1,3-dione |
| SMILES | O=C(c1c(F)c(F)c(F)c(F)c1F)C(F)C(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C16HF21O2/c17-2-1(3(18)5(20)6(21)4(2)19)8(38)7(22)9(39)10(23,24)11(25,26)12(27,28)13(29,30)14(31,32)15(33,34)16(35,36)37/h7H |
| InChIKey | IXRGOVDRTHHEKU-UHFFFAOYSA-N |
| XLogP | 6.85 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.14 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|