C19HF30N2O2+ — CID 155668519
[difluoro(1,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-heptadecafluoronon-1-enoxy)methyl]-[(2,3,4,5,6-pentafluorobenzoyl)amino]-bis(trifluoromethyl)azanium (PubChem CID 155668519) has the molecular formula C19HF30N2O2+ and a molecular weight of 859.17 g/mol. Its IUPAC name is [difluoro(1,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-heptadecafluoronon-1-enoxy)methyl]-[(2,3,4,5,6-pentafluorobenzoyl)amino]-bis(trifluoromethyl)azanium.
| Compound Name | [difluoro(1,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-heptadecafluoronon-1-enoxy)methyl]-[(2,3,4,5,6-pentafluorobenzoyl)amino]-bis(trifluoromethyl)azanium |
|---|---|
| PubChem CID | 155668519 |
| Molecular Formula | C19HF30N2O2+ |
| Molecular Weight | 859.17 g/mol |
| Exact Mass | 858.96 |
| IUPAC Name | [difluoro(1,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-heptadecafluoronon-1-enoxy)methyl]-[(2,3,4,5,6-pentafluorobenzoyl)amino]-bis(trifluoromethyl)azanium |
| SMILES | O=C(N[N+](C(F)(F)F)(C(F)(F)F)C(F)(F)OC(F)=C(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C19F30N2O2/c20-2-1(3(21)5(23)6(24)4(2)22)9(52)50-51(17(42,43)44,18(45,46)47)19(48,49)53-8(26)7(25)10(27,28)11(29,30)12(31,32)13(33,34)14(35,36)15(37,38)16(39,40)41/p+1 |
| InChIKey | XOYUDGYDKMJFGO-UHFFFAOYSA-O |
| XLogP | 9.93 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 859.17 |
| LogP ≤ 5 | 9.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|