C16H22N6O7S — CID 140519279
(2S)-2-[[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl-methylamino]-4-carboxysulfanylbutanoic acid (PubChem CID 140519279) has the molecular formula C16H22N6O7S and a molecular weight of 442.45 g/mol. Its IUPAC name is (2S)-2-[[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl-methylamino]-4-carboxysulfanylbutanoic acid.
| Compound Name | (2S)-2-[[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl-methylamino]-4-carboxysulfanylbutanoic acid |
|---|---|
| PubChem CID | 140519279 |
| Molecular Formula | C16H22N6O7S |
| Molecular Weight | 442.45 g/mol |
| Exact Mass | 442.13 |
| IUPAC Name | (2S)-2-[[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl-methylamino]-4-carboxysulfanylbutanoic acid |
| SMILES | CN(C[C@H]1O[C@@H](n2cnc3c(N)ncnc32)[C@H](O)[C@@H]1O)[C@@H](CCSC(=O)O)C(=O)O |
| InChI | InChI=1S/C16H22N6O7S/c1-21(7(15(25)26)2-3-30-16(27)28)4-8-10(23)11(24)14(29-8)22-6-20-9-12(17)18-5-19-13(9)22/h5-8,10-11,14,23-24H,2-4H2,1H3,(H,25,26)(H,27,28)(H2,17,18,19)/t7-,8+,10+,11+,14+/m0/s1 |
| InChIKey | BHQHATCPINLZEB-TWBCTODHSA-N |
| XLogP | -0.79 |
| TPSA | 197.15 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.45 |
| LogP ≤ 5 | -0.79 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|