C23H21N5O2S — CID 140523511
N-[(3,4-dimethoxyphenyl)methyl]-5-pyrazol-1-yl-8-thia-4,6-diazatetracyclo[7.5.0.02,7.010,14]tetradeca-1(9),2,4,6,13-pentaen-3-amine (PubChem CID 140523511) has the molecular formula C23H21N5O2S and a molecular weight of 431.52 g/mol. Its IUPAC name is N-[(3,4-dimethoxyphenyl)methyl]-5-pyrazol-1-yl-8-thia-4,6-diazatetracyclo[7.5.0.02,7.010,14]tetradeca-1(9),2,4,6,13-pentaen-3-amine.
| Compound Name | N-[(3,4-dimethoxyphenyl)methyl]-5-pyrazol-1-yl-8-thia-4,6-diazatetracyclo[7.5.0.02,7.010,14]tetradeca-1(9),2,4,6,13-pentaen-3-amine |
|---|---|
| PubChem CID | 140523511 |
| Molecular Formula | C23H21N5O2S |
| Molecular Weight | 431.52 g/mol |
| Exact Mass | 431.14 |
| IUPAC Name | N-[(3,4-dimethoxyphenyl)methyl]-5-pyrazol-1-yl-8-thia-4,6-diazatetracyclo[7.5.0.02,7.010,14]tetradeca-1(9),2,4,6,13-pentaen-3-amine |
| SMILES | COc1ccc(CNc2nc(-n3cccn3)nc3sc4c(c23)C2=CCCC24)cc1OC |
| InChI | InChI=1S/C23H21N5O2S/c1-29-16-8-7-13(11-17(16)30-2)12-24-21-19-18-14-5-3-6-15(14)20(18)31-22(19)27-23(26-21)28-10-4-9-25-28/h4-5,7-11,15H,3,6,12H2,1-2H3,(H,24,26,27) |
| InChIKey | OBSKQJHZQVUXLU-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 74.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.52 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |