C14H23N4O11P — CID 140531723
[(2R,3S,4R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl [3-(2-hydroxyethoxy)propanoylamino] hydrogen phosphate (PubChem CID 140531723) has the molecular formula C14H23N4O11P and a molecular weight of 454.33 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl [3-(2-hydroxyethoxy)propanoylamino] hydrogen phosphate.
| Compound Name | [(2R,3S,4R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl [3-(2-hydroxyethoxy)propanoylamino] hydrogen phosphate |
|---|---|
| PubChem CID | 140531723 |
| Molecular Formula | C14H23N4O11P |
| Molecular Weight | 454.33 g/mol |
| Exact Mass | 454.11 |
| IUPAC Name | [(2R,3S,4R,5R)-5-(4-amino-2-oxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]methyl [3-(2-hydroxyethoxy)propanoylamino] hydrogen phosphate |
| SMILES | Nc1ccn([C@@H]2O[C@H](COP(=O)(O)ONC(=O)CCOCCO)[C@@H](O)[C@H]2O)c(=O)n1 |
| InChI | InChI=1S/C14H23N4O11P/c15-9-1-3-18(14(23)16-9)13-12(22)11(21)8(28-13)7-27-30(24,25)29-17-10(20)2-5-26-6-4-19/h1,3,8,11-13,19,21-22H,2,4-7H2,(H,17,20)(H,24,25)(H2,15,16,23)/t8-,11-,12-,13-/m1/s1 |
| InChIKey | RZIDOBBKJFZJIL-HUXSOILUSA-N |
| XLogP | -2.99 |
| TPSA | 224.92 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.33 |
| LogP ≤ 5 | -2.99 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|