C18H22O19 — CID 140538441
4-O-[1-formylperoxy-3-hydroxy-2-(2-hydroxypropanoyloxy)-1-oxobutan-2-yl] 1-O-[2-formylperoxy-1-(2-hydroxypropanoyloxy)-2-oxoethyl] butanedioate (PubChem CID 140538441) has the molecular formula C18H22O19 and a molecular weight of 542.36 g/mol. Its IUPAC name is 4-O-[1-formylperoxy-3-hydroxy-2-(2-hydroxypropanoyloxy)-1-oxobutan-2-yl] 1-O-[2-formylperoxy-1-(2-hydroxypropanoyloxy)-2-oxoethyl] butanedioate.
| Compound Name | 4-O-[1-formylperoxy-3-hydroxy-2-(2-hydroxypropanoyloxy)-1-oxobutan-2-yl] 1-O-[2-formylperoxy-1-(2-hydroxypropanoyloxy)-2-oxoethyl] butanedioate |
|---|---|
| PubChem CID | 140538441 |
| Molecular Formula | C18H22O19 |
| Molecular Weight | 542.36 g/mol |
| Exact Mass | 542.08 |
| IUPAC Name | 4-O-[1-formylperoxy-3-hydroxy-2-(2-hydroxypropanoyloxy)-1-oxobutan-2-yl] 1-O-[2-formylperoxy-1-(2-hydroxypropanoyloxy)-2-oxoethyl] butanedioate |
| SMILES | CC(O)C(=O)OC(OC(=O)CCC(=O)OC(OC(=O)C(C)O)(C(=O)OOC=O)C(C)O)C(=O)OOC=O |
| InChI | InChI=1S/C18H22O19/c1-8(21)13(26)33-16(15(28)36-30-6-19)32-11(24)4-5-12(25)34-18(10(3)23,17(29)37-31-7-20)35-14(27)9(2)22/h6-10,16,21-23H,4-5H2,1-3H3 |
| InChIKey | QFNQOFFQODOEKB-UHFFFAOYSA-N |
| XLogP | -3.63 |
| TPSA | 271.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 19 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.36 |
| LogP ≤ 5 | -3.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 19 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|