C15H15ClN2S — CID 14053872
7-chloro-2-piperidin-1-yl-4H-indeno[1,2-d][1,3]thiazole (PubChem CID 14053872) has the molecular formula C15H15ClN2S and a molecular weight of 290.82 g/mol. Its IUPAC name is 7-chloro-2-piperidin-1-yl-4H-indeno[1,2-d][1,3]thiazole.
| Compound Name | 7-chloro-2-piperidin-1-yl-4H-indeno[1,2-d][1,3]thiazole |
|---|---|
| PubChem CID | 14053872 |
| Molecular Formula | C15H15ClN2S |
| Molecular Weight | 290.82 g/mol |
| Exact Mass | 290.06 |
| IUPAC Name | 7-chloro-2-piperidin-1-yl-4H-indeno[1,2-d][1,3]thiazole |
| SMILES | Clc1ccc2c(c1)-c1nc(N3CCCCC3)sc1C2 |
| InChI | InChI=1S/C15H15ClN2S/c16-11-5-4-10-8-13-14(12(10)9-11)17-15(19-13)18-6-2-1-3-7-18/h4-5,9H,1-3,6-8H2 |
| InChIKey | JRCWNVPOPRVRAX-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.82 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |