C18H17Cl2N5S2 — CID 3884823
3,5-dichloro-N-[(2-piperidin-1-yl-4-thiophen-2-yl-1,3-thiazol-5-yl)methylideneamino]pyridin-2-amine (PubChem CID 3884823) has the molecular formula C18H17Cl2N5S2 and a molecular weight of 438.41 g/mol. Its IUPAC name is 3,5-dichloro-N-[(2-piperidin-1-yl-4-thiophen-2-yl-1,3-thiazol-5-yl)methylideneamino]pyridin-2-amine.
| Compound Name | 3,5-dichloro-N-[(2-piperidin-1-yl-4-thiophen-2-yl-1,3-thiazol-5-yl)methylideneamino]pyridin-2-amine |
|---|---|
| PubChem CID | 3884823 |
| Molecular Formula | C18H17Cl2N5S2 |
| Molecular Weight | 438.41 g/mol |
| Exact Mass | 437.03 |
| IUPAC Name | 3,5-dichloro-N-[(2-piperidin-1-yl-4-thiophen-2-yl-1,3-thiazol-5-yl)methylideneamino]pyridin-2-amine |
| SMILES | Clc1cnc(NN=Cc2sc(N3CCCCC3)nc2-c2cccs2)c(Cl)c1 |
| InChI | InChI=1S/C18H17Cl2N5S2/c19-12-9-13(20)17(21-10-12)24-22-11-15-16(14-5-4-8-26-14)23-18(27-15)25-6-2-1-3-7-25/h4-5,8-11H,1-3,6-7H2,(H,21,24) |
| InChIKey | QEWIVNOVGSONRQ-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 53.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.41 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|