C14H22Br2O — CID 140539382
5,13-dibromo-9-oxatricyclo[9.4.0.02,7]pentadecane (PubChem CID 140539382) has the molecular formula C14H22Br2O and a molecular weight of 366.14 g/mol. Its IUPAC name is 5,13-dibromo-9-oxatricyclo[9.4.0.02,7]pentadecane.
| Compound Name | 5,13-dibromo-9-oxatricyclo[9.4.0.02,7]pentadecane |
|---|---|
| PubChem CID | 140539382 |
| Molecular Formula | C14H22Br2O |
| Molecular Weight | 366.14 g/mol |
| Exact Mass | 364.00 |
| IUPAC Name | 5,13-dibromo-9-oxatricyclo[9.4.0.02,7]pentadecane |
| SMILES | BrC1CCC2C(COCC3CC(Br)CCC32)C1 |
| InChI | InChI=1S/C14H22Br2O/c15-11-1-3-13-9(5-11)7-17-8-10-6-12(16)2-4-14(10)13/h9-14H,1-8H2 |
| InChIKey | YSXRERKZRKITNV-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.14 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|