About 5,13-dibromo-9-oxatricyclo[9.4.0.02,7]pentadecane
5,13-dibromo-9-oxatricyclo[9.4.0.02,7]pentadecane (PubChem CID 140539382) has the molecular formula C14H22Br2O
and a molecular weight of 366.14 g/mol. Its IUPAC name is 5,13-dibromo-9-oxatricyclo[9.4.0.02,7]pentadecane.
Molecular Properties
| Compound Name | 5,13-dibromo-9-oxatricyclo[9.4.0.02,7]pentadecane |
| PubChem CID | 140539382 |
| Molecular Formula | C14H22Br2O |
| Molecular Weight | 366.14 g/mol |
| Exact Mass | 364.00 |
| IUPAC Name | 5,13-dibromo-9-oxatricyclo[9.4.0.02,7]pentadecane |
| SMILES | BrC1CCC2C(COCC3CC(Br)CCC32)C1 |
| InChI | InChI=1S/C14H22Br2O/c15-11-1-3-13-9(5-11)7-17-8-10-6-12(16)2-4-14(10)13/h9-14H,1-8H2 |
| InChIKey | YSXRERKZRKITNV-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 366.14 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 5,13-dibromo-9-oxatricyclo[9.4.0.02,7]pentadecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,13-dibromo-9-oxatricyclo[9.4.0.02,7]pentadecane?
The IUPAC name of 5,13-dibromo-9-oxatricyclo[9.4.0.02,7]pentadecane (CID 140539382) is 5,13-dibromo-9-oxatricyclo[9.4.0.02,7]pentadecane.
What is the SMILES notation for 5,13-dibromo-9-oxatricyclo[9.4.0.02,7]pentadecane?
The canonical SMILES for 5,13-dibromo-9-oxatricyclo[9.4.0.02,7]pentadecane is BrC1CCC2C(COCC3CC(Br)CCC32)C1.
What is the InChIKey of 5,13-dibromo-9-oxatricyclo[9.4.0.02,7]pentadecane?
The InChIKey is YSXRERKZRKITNV-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22Br2O/c15-11-1-3-13-9(5-11)7-17-8-10-6-12(16)2-4-14(10)13/h9-14H,1-8H2.
What are the key properties of 5,13-dibromo-9-oxatricyclo[9.4.0.02,7]pentadecane?
5,13-dibromo-9-oxatricyclo[9.4.0.02,7]pentadecane has a molecular weight of 366.14 g/mol, XLogP of 4.38, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5,13-dibromo-9-oxatricyclo[9.4.0.02,7]pentadecane is sourced from PubChem (CID 140539382), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).