C22H20F4O3S2 — CID 140546479
(triphenyl-λ4-sulfanyl) 1,1,2,2-tetrafluoro-4-hydroxybutane-1-sulfinate (PubChem CID 140546479) has the molecular formula C22H20F4O3S2 and a molecular weight of 472.53 g/mol. Its IUPAC name is (triphenyl-λ4-sulfanyl) 1,1,2,2-tetrafluoro-4-hydroxybutane-1-sulfinate.
| Compound Name | (triphenyl-λ4-sulfanyl) 1,1,2,2-tetrafluoro-4-hydroxybutane-1-sulfinate |
|---|---|
| PubChem CID | 140546479 |
| Molecular Formula | C22H20F4O3S2 |
| Molecular Weight | 472.53 g/mol |
| Exact Mass | 472.08 |
| IUPAC Name | (triphenyl-λ4-sulfanyl) 1,1,2,2-tetrafluoro-4-hydroxybutane-1-sulfinate |
| SMILES | O=S(OS(c1ccccc1)(c1ccccc1)c1ccccc1)C(F)(F)C(F)(F)CCO |
| InChI | InChI=1S/C22H20F4O3S2/c23-21(24,16-17-27)22(25,26)30(28)29-31(18-10-4-1-5-11-18,19-12-6-2-7-13-19)20-14-8-3-9-15-20/h1-15,27H,16-17H2 |
| InChIKey | YJJWMBLNQPAUAL-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.53 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|