About 1-pyridin-4-ylethyl pyridine-3-carboperoxoate
1-pyridin-4-ylethyl pyridine-3-carboperoxoate (PubChem CID 140551609) has the molecular formula C13H12N2O3
and a molecular weight of 244.25 g/mol. Its IUPAC name is 1-pyridin-4-ylethyl pyridine-3-carboperoxoate.
Molecular Properties
| Compound Name | 1-pyridin-4-ylethyl pyridine-3-carboperoxoate |
| PubChem CID | 140551609 |
| Molecular Formula | C13H12N2O3 |
| Molecular Weight | 244.25 g/mol |
| Exact Mass | 244.08 |
| IUPAC Name | 1-pyridin-4-ylethyl pyridine-3-carboperoxoate |
| SMILES | CC(OOC(=O)c1cccnc1)c1ccncc1 |
| InChI | InChI=1S/C13H12N2O3/c1-10(11-4-7-14-8-5-11)17-18-13(16)12-3-2-6-15-9-12/h2-10H,1H3 |
| InChIKey | RQAVXBWGGZBNPY-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 61.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.25 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze 1-pyridin-4-ylethyl pyridine-3-carboperoxoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-pyridin-4-ylethyl pyridine-3-carboperoxoate?
The IUPAC name of 1-pyridin-4-ylethyl pyridine-3-carboperoxoate (CID 140551609) is 1-pyridin-4-ylethyl pyridine-3-carboperoxoate.
What is the SMILES notation for 1-pyridin-4-ylethyl pyridine-3-carboperoxoate?
The canonical SMILES for 1-pyridin-4-ylethyl pyridine-3-carboperoxoate is CC(OOC(=O)c1cccnc1)c1ccncc1.
What is the InChIKey of 1-pyridin-4-ylethyl pyridine-3-carboperoxoate?
The InChIKey is RQAVXBWGGZBNPY-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12N2O3/c1-10(11-4-7-14-8-5-11)17-18-13(16)12-3-2-6-15-9-12/h2-10H,1H3.
What are the key properties of 1-pyridin-4-ylethyl pyridine-3-carboperoxoate?
1-pyridin-4-ylethyl pyridine-3-carboperoxoate has a molecular weight of 244.25 g/mol, XLogP of 2.33, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-pyridin-4-ylethyl pyridine-3-carboperoxoate is sourced from PubChem (CID 140551609), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).