C54H105O4P — CID 140554200
tris(2,6,10-trimethyl-3-prop-2-enyldodecyl) phosphate (PubChem CID 140554200) has the molecular formula C54H105O4P and a molecular weight of 849.40 g/mol. Its IUPAC name is tris(2,6,10-trimethyl-3-prop-2-enyldodecyl) phosphate.
| Compound Name | tris(2,6,10-trimethyl-3-prop-2-enyldodecyl) phosphate |
|---|---|
| PubChem CID | 140554200 |
| Molecular Formula | C54H105O4P |
| Molecular Weight | 849.40 g/mol |
| Exact Mass | 848.78 |
| IUPAC Name | tris(2,6,10-trimethyl-3-prop-2-enyldodecyl) phosphate |
| SMILES | C=CCC(CCC(C)CCCC(C)CC)C(C)COP(=O)(OCC(C)C(CC=C)CCC(C)CCCC(C)CC)OCC(C)C(CC=C)CCC(C)CCCC(C)CC |
| InChI | InChI=1S/C54H105O4P/c1-16-25-52(37-34-46(10)31-22-28-43(7)19-4)49(13)40-56-59(55,57-41-50(14)53(26-17-2)38-35-47(11)32-23-29-44(8)20-5)58-42-51(15)54(27-18-3)39-36-48(12)33-24-30-45(9)21-6/h16-18,43-54H,1-3,19-42H2,4-15H3 |
| InChIKey | CHPWEJZDPSWWBY-UHFFFAOYSA-N |
| XLogP | 18.53 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 42 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 849.40 |
| LogP ≤ 5 | 18.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|