C11H12N6O6 — CID 140559695
2-amino-9-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-3-isocyanatopurin-6-one (PubChem CID 140559695) has the molecular formula C11H12N6O6 and a molecular weight of 324.25 g/mol. Its IUPAC name is 2-amino-9-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-3-isocyanatopurin-6-one.
| Compound Name | 2-amino-9-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-3-isocyanatopurin-6-one |
|---|---|
| PubChem CID | 140559695 |
| Molecular Formula | C11H12N6O6 |
| Molecular Weight | 324.25 g/mol |
| Exact Mass | 324.08 |
| IUPAC Name | 2-amino-9-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-3-isocyanatopurin-6-one |
| SMILES | Nc1nc(=O)c2ncn(C3OC(CO)C(O)C3O)c2n1N=C=O |
| InChI | InChI=1S/C11H12N6O6/c12-11-15-8(22)5-9(17(11)14-3-19)16(2-13-5)10-7(21)6(20)4(1-18)23-10/h2,4,6-7,10,18,20-21H,1H2,(H2,12,15,22) |
| InChIKey | KZHFWSYDHPITSV-UHFFFAOYSA-N |
| XLogP | -3.11 |
| TPSA | 178.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.25 |
| LogP ≤ 5 | -3.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|