About CID 140565655
CID 140565655 (PubChem CID 140565655) has the molecular formula C12H28N2Na2O8S2
and a molecular weight of 438.48 g/mol.
Molecular Properties
| Compound Name | CID 140565655 |
| PubChem CID | 140565655 |
| Molecular Formula | C12H28N2Na2O8S2 |
| Molecular Weight | 438.48 g/mol |
| Exact Mass | 438.11 |
| IUPAC Name | — |
| SMILES | CCN(CCOCSOOO)CCN(CC)CCOCSOOO.[Na].[Na] |
| InChI | InChI=1S/C12H28N2O8S2.2Na/c1-3-13(7-9-17-11-23-21-19-15)5-6-14(4-2)8-10-18-12-24-22-20-16;;/h15-16H,3-12H2,1-2H3;; |
| InChIKey | FHSULKAFZGHORA-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 102.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 438.48 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze CID 140565655 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 140565655?
The IUPAC name of CID 140565655 (CID 140565655) is not available.
What is the SMILES notation for CID 140565655?
The canonical SMILES for CID 140565655 is CCN(CCOCSOOO)CCN(CC)CCOCSOOO.[Na].[Na].
What is the InChIKey of CID 140565655?
The InChIKey is FHSULKAFZGHORA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H28N2O8S2.2Na/c1-3-13(7-9-17-11-23-21-19-15)5-6-14(4-2)8-10-18-12-24-22-20-16;;/h15-16H,3-12H2,1-2H3;;.
What are the key properties of CID 140565655?
CID 140565655 has a molecular weight of 438.48 g/mol, XLogP of 0.96, 19 rotatable bonds, 2 hydrogen bond donors, and 12 hydrogen bond acceptors.
Where does this data come from?
All data for CID 140565655 is sourced from PubChem (CID 140565655), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).