C11H22O4S — CID 140569211
4-methyl-4-nonan-3-yl-1,3,2-dioxathietane 2,2-dioxide (PubChem CID 140569211) has the molecular formula C11H22O4S and a molecular weight of 250.36 g/mol. Its IUPAC name is 4-methyl-4-nonan-3-yl-1,3,2-dioxathietane 2,2-dioxide.
| Compound Name | 4-methyl-4-nonan-3-yl-1,3,2-dioxathietane 2,2-dioxide |
|---|---|
| PubChem CID | 140569211 |
| Molecular Formula | C11H22O4S |
| Molecular Weight | 250.36 g/mol |
| Exact Mass | 250.12 |
| IUPAC Name | 4-methyl-4-nonan-3-yl-1,3,2-dioxathietane 2,2-dioxide |
| SMILES | CCCCCCC(CC)C1(C)OS(=O)(=O)O1 |
| InChI | InChI=1S/C11H22O4S/c1-4-6-7-8-9-10(5-2)11(3)14-16(12,13)15-11/h10H,4-9H2,1-3H3 |
| InChIKey | UFXKYTQYZQVSRE-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.36 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|