About 2-chloro-2,3-dimethyl-3-tridecan-4-yloxirane
2-chloro-2,3-dimethyl-3-tridecan-4-yloxirane (PubChem CID 141375232) has the molecular formula C17H33ClO
and a molecular weight of 288.90 g/mol. Its IUPAC name is 2-chloro-2,3-dimethyl-3-tridecan-4-yloxirane.
Molecular Properties
| Compound Name | 2-chloro-2,3-dimethyl-3-tridecan-4-yloxirane |
| PubChem CID | 141375232 |
| Molecular Formula | C17H33ClO |
| Molecular Weight | 288.90 g/mol |
| Exact Mass | 288.22 |
| IUPAC Name | 2-chloro-2,3-dimethyl-3-tridecan-4-yloxirane |
| SMILES | CCCCCCCCCC(CCC)C1(C)OC1(C)Cl |
| InChI | InChI=1S/C17H33ClO/c1-5-7-8-9-10-11-12-14-15(13-6-2)16(3)17(4,18)19-16/h15H,5-14H2,1-4H3 |
| InChIKey | GGSMEQILZHKVRA-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 288.90 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-2,3-dimethyl-3-tridecan-4-yloxirane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-2,3-dimethyl-3-tridecan-4-yloxirane?
The IUPAC name of 2-chloro-2,3-dimethyl-3-tridecan-4-yloxirane (CID 141375232) is 2-chloro-2,3-dimethyl-3-tridecan-4-yloxirane.
What is the SMILES notation for 2-chloro-2,3-dimethyl-3-tridecan-4-yloxirane?
The canonical SMILES for 2-chloro-2,3-dimethyl-3-tridecan-4-yloxirane is CCCCCCCCCC(CCC)C1(C)OC1(C)Cl.
What is the InChIKey of 2-chloro-2,3-dimethyl-3-tridecan-4-yloxirane?
The InChIKey is GGSMEQILZHKVRA-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H33ClO/c1-5-7-8-9-10-11-12-14-15(13-6-2)16(3)17(4,18)19-16/h15H,5-14H2,1-4H3.
What are the key properties of 2-chloro-2,3-dimethyl-3-tridecan-4-yloxirane?
2-chloro-2,3-dimethyl-3-tridecan-4-yloxirane has a molecular weight of 288.90 g/mol, XLogP of 6.29, 11 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-2,3-dimethyl-3-tridecan-4-yloxirane is sourced from PubChem (CID 141375232), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).