C12H20Cl4O — CID 151966164
2,2,3-trichloro-3-(1-chlorodecyl)oxirane (PubChem CID 151966164) has the molecular formula C12H20Cl4O and a molecular weight of 322.10 g/mol. Its IUPAC name is 2,2,3-trichloro-3-(1-chlorodecyl)oxirane.
| Compound Name | 2,2,3-trichloro-3-(1-chlorodecyl)oxirane |
|---|---|
| PubChem CID | 151966164 |
| Molecular Formula | C12H20Cl4O |
| Molecular Weight | 322.10 g/mol |
| Exact Mass | 320.03 |
| IUPAC Name | 2,2,3-trichloro-3-(1-chlorodecyl)oxirane |
| SMILES | CCCCCCCCCC(Cl)C1(Cl)OC1(Cl)Cl |
| InChI | InChI=1S/C12H20Cl4O/c1-2-3-4-5-6-7-8-9-10(13)11(14)12(15,16)17-11/h10H,2-9H2,1H3 |
| InChIKey | TZRYVNCJQXHNMI-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.10 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|