C20H16F2N2O2 — CID 140578810
2-[2-[(2,6-difluorophenyl)methoxyimino]ethyl]naphthalene-1-carboxamide (PubChem CID 140578810) has the molecular formula C20H16F2N2O2 and a molecular weight of 354.36 g/mol. Its IUPAC name is 2-[2-[(2,6-difluorophenyl)methoxyimino]ethyl]naphthalene-1-carboxamide.
| Compound Name | 2-[2-[(2,6-difluorophenyl)methoxyimino]ethyl]naphthalene-1-carboxamide |
|---|---|
| PubChem CID | 140578810 |
| Molecular Formula | C20H16F2N2O2 |
| Molecular Weight | 354.36 g/mol |
| Exact Mass | 354.12 |
| IUPAC Name | 2-[2-[(2,6-difluorophenyl)methoxyimino]ethyl]naphthalene-1-carboxamide |
| SMILES | NC(=O)c1c(CC=NOCc2c(F)cccc2F)ccc2ccccc12 |
| InChI | InChI=1S/C20H16F2N2O2/c21-17-6-3-7-18(22)16(17)12-26-24-11-10-14-9-8-13-4-1-2-5-15(13)19(14)20(23)25/h1-9,11H,10,12H2,(H2,23,25) |
| InChIKey | DHBRLKDAUQSFJY-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.36 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|