C5H9NaO2S2 — CID 140578858
sodium 2,3-bis(methylsulfanyl)propanoate (PubChem CID 140578858) has the molecular formula C5H9NaO2S2 and a molecular weight of 188.25 g/mol. Its IUPAC name is sodium 2,3-bis(methylsulfanyl)propanoate.
| Compound Name | sodium 2,3-bis(methylsulfanyl)propanoate |
|---|---|
| PubChem CID | 140578858 |
| Molecular Formula | C5H9NaO2S2 |
| Molecular Weight | 188.25 g/mol |
| Exact Mass | 187.99 |
| IUPAC Name | sodium 2,3-bis(methylsulfanyl)propanoate |
| SMILES | CSCC(SC)C(=O)[O-].[Na+] |
| InChI | InChI=1S/C5H10O2S2.Na/c1-8-3-4(9-2)5(6)7;/h4H,3H2,1-2H3,(H,6,7);/q;+1/p-1 |
| InChIKey | LPJAAFCQNZFFGA-UHFFFAOYSA-M |
| XLogP | -3.17 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.25 |
| LogP ≤ 5 | -3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |