potassium 2,3-bis(methylsulfanyl)propanoate

C5H9KO2S2 — CID 140576902

IUPACpotassium 2,3-bis(methylsulfanyl)propanoate
SMILESCSCC(SC)C(=O)[O-].[K+]
InChIInChI=1S/C5H10O2S2.K/c1-8-3-4(9-2)5(6)7;/h4H,3H2,1-2H3,(H,6,7);/q;+1/p-1
InChIKeyOOIWGDHGNCXVFE-UHFFFAOYSA-M
MW204.36 g/mol
LogP-3.17
Rot. Bonds4

About potassium 2,3-bis(methylsulfanyl)propanoate

potassium 2,3-bis(methylsulfanyl)propanoate (PubChem CID 140576902) has the molecular formula C5H9KO2S2 and a molecular weight of 204.36 g/mol. Its IUPAC name is potassium 2,3-bis(methylsulfanyl)propanoate.

Molecular Properties

Compound Namepotassium 2,3-bis(methylsulfanyl)propanoate
PubChem CID140576902
Molecular FormulaC5H9KO2S2
Molecular Weight204.36 g/mol
Exact Mass203.97
IUPAC Namepotassium 2,3-bis(methylsulfanyl)propanoate
SMILESCSCC(SC)C(=O)[O-].[K+]
InChIInChI=1S/C5H10O2S2.K/c1-8-3-4(9-2)5(6)7;/h4H,3H2,1-2H3,(H,6,7);/q;+1/p-1
InChIKeyOOIWGDHGNCXVFE-UHFFFAOYSA-M
XLogP-3.17
TPSA40.13 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms10
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500204.36
LogP ≤ 5-3.17
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze potassium 2,3-bis(methylsulfanyl)propanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of potassium 2,3-bis(methylsulfanyl)propanoate?
The IUPAC name of potassium 2,3-bis(methylsulfanyl)propanoate (CID 140576902) is potassium 2,3-bis(methylsulfanyl)propanoate.
What is the SMILES notation for potassium 2,3-bis(methylsulfanyl)propanoate?
The canonical SMILES for potassium 2,3-bis(methylsulfanyl)propanoate is CSCC(SC)C(=O)[O-].[K+].
What is the InChIKey of potassium 2,3-bis(methylsulfanyl)propanoate?
The InChIKey is OOIWGDHGNCXVFE-UHFFFAOYSA-M. The full InChI is InChI=1S/C5H10O2S2.K/c1-8-3-4(9-2)5(6)7;/h4H,3H2,1-2H3,(H,6,7);/q;+1/p-1.
What are the key properties of potassium 2,3-bis(methylsulfanyl)propanoate?
potassium 2,3-bis(methylsulfanyl)propanoate has a molecular weight of 204.36 g/mol, XLogP of -3.17, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for potassium 2,3-bis(methylsulfanyl)propanoate is sourced from PubChem (CID 140576902), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).