C38H47N4S2+ — CID 140586789
2-[(E)-2-(4-pyrrolidin-1-ylcyclohexa-1,3-dien-1-yl)ethenyl]-1-[2-[2-[6-[(E)-2-(4-pyrrolidin-1-ylphenyl)ethenyl]-2H-pyridin-1-yl]ethyldisulfanyl]ethyl]pyridin-1-ium (PubChem CID 140586789) has the molecular formula C38H47N4S2+ and a molecular weight of 623.96 g/mol. Its IUPAC name is 2-[(E)-2-(4-pyrrolidin-1-ylcyclohexa-1,3-dien-1-yl)ethenyl]-1-[2-[2-[6-[(E)-2-(4-pyrrolidin-1-ylphenyl)ethenyl]-2H-pyridin-1-yl]ethyldisulfanyl]ethyl]pyridin-1-ium.
| Compound Name | 2-[(E)-2-(4-pyrrolidin-1-ylcyclohexa-1,3-dien-1-yl)ethenyl]-1-[2-[2-[6-[(E)-2-(4-pyrrolidin-1-ylphenyl)ethenyl]-2H-pyridin-1-yl]ethyldisulfanyl]ethyl]pyridin-1-ium |
|---|---|
| PubChem CID | 140586789 |
| Molecular Formula | C38H47N4S2+ |
| Molecular Weight | 623.96 g/mol |
| Exact Mass | 623.32 |
| IUPAC Name | 2-[(E)-2-(4-pyrrolidin-1-ylcyclohexa-1,3-dien-1-yl)ethenyl]-1-[2-[2-[6-[(E)-2-(4-pyrrolidin-1-ylphenyl)ethenyl]-2H-pyridin-1-yl]ethyldisulfanyl]ethyl]pyridin-1-ium |
| SMILES | C1=CCN(CCSSCC[n+]2ccccc2/C=C/C2=CC=C(N3CCCC3)CC2)C(/C=C/c2ccc(N3CCCC3)cc2)=C1 |
| InChI | InChI=1S/C38H47N4S2/c1-3-23-41(35(9-1)17-11-33-13-19-37(20-14-33)39-25-5-6-26-39)29-31-43-44-32-30-42-24-4-2-10-36(42)18-12-34-15-21-38(22-16-34)40-27-7-8-28-40/h1-4,9-15,17-21,24H,5-8,16,22-23,25-32H2/q+1/b17-11+ |
| InChIKey | DIEPHCIYDYXSGM-GZTJUZNOSA-N |
| XLogP | 8.14 |
| TPSA | 13.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.96 |
| LogP ≤ 5 | 8.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|