C14H17F2O7S- — CID 140590505
1,1-difluoro-2-[6-(2-methylprop-2-enoyloxy)bicyclo[2.2.1]heptane-2-carbonyl]oxyethanesulfonate (PubChem CID 140590505) has the molecular formula C14H17F2O7S- and a molecular weight of 367.35 g/mol. Its IUPAC name is 1,1-difluoro-2-[6-(2-methylprop-2-enoyloxy)bicyclo[2.2.1]heptane-2-carbonyl]oxyethanesulfonate.
| Compound Name | 1,1-difluoro-2-[6-(2-methylprop-2-enoyloxy)bicyclo[2.2.1]heptane-2-carbonyl]oxyethanesulfonate |
|---|---|
| PubChem CID | 140590505 |
| Molecular Formula | C14H17F2O7S- |
| Molecular Weight | 367.35 g/mol |
| Exact Mass | 367.07 |
| IUPAC Name | 1,1-difluoro-2-[6-(2-methylprop-2-enoyloxy)bicyclo[2.2.1]heptane-2-carbonyl]oxyethanesulfonate |
| SMILES | C=C(C)C(=O)OC1CC2CC(C(=O)OCC(F)(F)S(=O)(=O)[O-])C1C2 |
| InChI | InChI=1S/C14H18F2O7S/c1-7(2)12(17)23-11-5-8-3-9(11)10(4-8)13(18)22-6-14(15,16)24(19,20)21/h8-11H,1,3-6H2,2H3,(H,19,20,21)/p-1 |
| InChIKey | KMCLPEDACCVNNP-UHFFFAOYSA-M |
| XLogP | 1.20 |
| TPSA | 109.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.35 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|