About pyrimido[2,1-a][2,6]naphthyridin-4-one
pyrimido[2,1-a][2,6]naphthyridin-4-one (PubChem CID 140590865) has the molecular formula C11H7N3O
and a molecular weight of 197.20 g/mol. Its IUPAC name is pyrimido[2,1-a][2,6]naphthyridin-4-one.
Molecular Properties
| Compound Name | pyrimido[2,1-a][2,6]naphthyridin-4-one |
| PubChem CID | 140590865 |
| Molecular Formula | C11H7N3O |
| Molecular Weight | 197.20 g/mol |
| Exact Mass | 197.06 |
| IUPAC Name | pyrimido[2,1-a][2,6]naphthyridin-4-one |
| SMILES | O=c1ccnc2c3ccncc3ccn12 |
| InChI | InChI=1S/C11H7N3O/c15-10-2-5-13-11-9-1-4-12-7-8(9)3-6-14(10)11/h1-7H |
| InChIKey | GWVCISZZALOEMG-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 47.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.20 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze pyrimido[2,1-a][2,6]naphthyridin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyrimido[2,1-a][2,6]naphthyridin-4-one?
The IUPAC name of pyrimido[2,1-a][2,6]naphthyridin-4-one (CID 140590865) is pyrimido[2,1-a][2,6]naphthyridin-4-one.
What is the SMILES notation for pyrimido[2,1-a][2,6]naphthyridin-4-one?
The canonical SMILES for pyrimido[2,1-a][2,6]naphthyridin-4-one is O=c1ccnc2c3ccncc3ccn12.
What is the InChIKey of pyrimido[2,1-a][2,6]naphthyridin-4-one?
The InChIKey is GWVCISZZALOEMG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H7N3O/c15-10-2-5-13-11-9-1-4-12-7-8(9)3-6-14(10)11/h1-7H.
What are the key properties of pyrimido[2,1-a][2,6]naphthyridin-4-one?
pyrimido[2,1-a][2,6]naphthyridin-4-one has a molecular weight of 197.20 g/mol, XLogP of 1.24, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for pyrimido[2,1-a][2,6]naphthyridin-4-one is sourced from PubChem (CID 140590865), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).