C12H11N3 — CID 140590948
4-methyl-[1,2,4]triazino[3,2-a]isoquinoline (PubChem CID 140590948) has the molecular formula C12H11N3 and a molecular weight of 197.24 g/mol. Its IUPAC name is 4-methyl-[1,2,4]triazino[3,2-a]isoquinoline.
| Compound Name | 4-methyl-[1,2,4]triazino[3,2-a]isoquinoline |
|---|---|
| PubChem CID | 140590948 |
| Molecular Formula | C12H11N3 |
| Molecular Weight | 197.24 g/mol |
| Exact Mass | 197.10 |
| IUPAC Name | 4-methyl-[1,2,4]triazino[3,2-a]isoquinoline |
| SMILES | CN1C=CN=C2c3ccccc3C=CN21 |
| InChI | InChI=1S/C12H11N3/c1-14-9-7-13-12-11-5-3-2-4-10(11)6-8-15(12)14/h2-9H,1H3 |
| InChIKey | XCBGPEJZNJATSB-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.24 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |