C17H17N3Si — CID 177409767
3,3-dimethyl-2-phenyl-[1,2,4,3]triazasilolo[5,4-a]isoquinoline (PubChem CID 177409767) has the molecular formula C17H17N3Si and a molecular weight of 291.43 g/mol. Its IUPAC name is 3,3-dimethyl-2-phenyl-[1,2,4,3]triazasilolo[5,4-a]isoquinoline.
| Compound Name | 3,3-dimethyl-2-phenyl-[1,2,4,3]triazasilolo[5,4-a]isoquinoline |
|---|---|
| PubChem CID | 177409767 |
| Molecular Formula | C17H17N3Si |
| Molecular Weight | 291.43 g/mol |
| Exact Mass | 291.12 |
| IUPAC Name | 3,3-dimethyl-2-phenyl-[1,2,4,3]triazasilolo[5,4-a]isoquinoline |
| SMILES | C[Si]1(C)N2C=Cc3ccccc3C2=NN1c1ccccc1 |
| InChI | InChI=1S/C17H17N3Si/c1-21(2)19-13-12-14-8-6-7-11-16(14)17(19)18-20(21)15-9-4-3-5-10-15/h3-13H,1-2H3 |
| InChIKey | XAGRLIDBVOKHAJ-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.43 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|