C18H18N2 — CID 146184173
3,13-diazapentacyclo[14.2.2.02,15.03,12.06,11]icosa-2(15),4,6,8,10,12-hexaene (PubChem CID 146184173) has the molecular formula C18H18N2 and a molecular weight of 262.36 g/mol. Its IUPAC name is 3,13-diazapentacyclo[14.2.2.02,15.03,12.06,11]icosa-2(15),4,6,8,10,12-hexaene.
| Compound Name | 3,13-diazapentacyclo[14.2.2.02,15.03,12.06,11]icosa-2(15),4,6,8,10,12-hexaene |
|---|---|
| PubChem CID | 146184173 |
| Molecular Formula | C18H18N2 |
| Molecular Weight | 262.36 g/mol |
| Exact Mass | 262.15 |
| IUPAC Name | 3,13-diazapentacyclo[14.2.2.02,15.03,12.06,11]icosa-2(15),4,6,8,10,12-hexaene |
| SMILES | C1=CN2C(=NCC3=C2C2CCC3CC2)c2ccccc21 |
| InChI | InChI=1S/C18H18N2/c1-2-4-15-12(3-1)9-10-20-17-14-7-5-13(6-8-14)16(17)11-19-18(15)20/h1-4,9-10,13-14H,5-8,11H2 |
| InChIKey | YRKLNSXPOIJSJD-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.36 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |