C14H23ClN2O — CID 140594929
2-amino-5-chloro-3-cyclohexyl-3a,4,5,6,7,7a-hexahydroindol-3-ol (PubChem CID 140594929) has the molecular formula C14H23ClN2O and a molecular weight of 270.80 g/mol. Its IUPAC name is 2-amino-5-chloro-3-cyclohexyl-3a,4,5,6,7,7a-hexahydroindol-3-ol.
| Compound Name | 2-amino-5-chloro-3-cyclohexyl-3a,4,5,6,7,7a-hexahydroindol-3-ol |
|---|---|
| PubChem CID | 140594929 |
| Molecular Formula | C14H23ClN2O |
| Molecular Weight | 270.80 g/mol |
| Exact Mass | 270.15 |
| IUPAC Name | 2-amino-5-chloro-3-cyclohexyl-3a,4,5,6,7,7a-hexahydroindol-3-ol |
| SMILES | NC1=NC2CCC(Cl)CC2C1(O)C1CCCCC1 |
| InChI | InChI=1S/C14H23ClN2O/c15-10-6-7-12-11(8-10)14(18,13(16)17-12)9-4-2-1-3-5-9/h9-12,18H,1-8H2,(H2,16,17) |
| InChIKey | MGGYTEGEWBKIMP-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 58.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.80 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|