C17H28Cl2N2OS — CID 140594913
2-amino-5-chloro-3-(5-chloro-2-propan-2-ylsulfanylcyclohexyl)-3a,4,5,6,7,7a-hexahydroindol-3-ol (PubChem CID 140594913) has the molecular formula C17H28Cl2N2OS and a molecular weight of 379.40 g/mol. Its IUPAC name is 2-amino-5-chloro-3-(5-chloro-2-propan-2-ylsulfanylcyclohexyl)-3a,4,5,6,7,7a-hexahydroindol-3-ol.
| Compound Name | 2-amino-5-chloro-3-(5-chloro-2-propan-2-ylsulfanylcyclohexyl)-3a,4,5,6,7,7a-hexahydroindol-3-ol |
|---|---|
| PubChem CID | 140594913 |
| Molecular Formula | C17H28Cl2N2OS |
| Molecular Weight | 379.40 g/mol |
| Exact Mass | 378.13 |
| IUPAC Name | 2-amino-5-chloro-3-(5-chloro-2-propan-2-ylsulfanylcyclohexyl)-3a,4,5,6,7,7a-hexahydroindol-3-ol |
| SMILES | CC(C)SC1CCC(Cl)CC1C1(O)C(N)=NC2CCC(Cl)CC21 |
| InChI | InChI=1S/C17H28Cl2N2OS/c1-9(2)23-15-6-4-11(19)8-13(15)17(22)12-7-10(18)3-5-14(12)21-16(17)20/h9-15,22H,3-8H2,1-2H3,(H2,20,21) |
| InChIKey | AFGGLNOKMVHJOV-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 58.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.40 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|