C18H29ClN2O2 — CID 140594834
2-amino-5-chloro-3-(2-cyclopropyl-5-methoxycyclohexyl)-3a,4,5,6,7,7a-hexahydroindol-3-ol (PubChem CID 140594834) has the molecular formula C18H29ClN2O2 and a molecular weight of 340.90 g/mol. Its IUPAC name is 2-amino-5-chloro-3-(2-cyclopropyl-5-methoxycyclohexyl)-3a,4,5,6,7,7a-hexahydroindol-3-ol.
| Compound Name | 2-amino-5-chloro-3-(2-cyclopropyl-5-methoxycyclohexyl)-3a,4,5,6,7,7a-hexahydroindol-3-ol |
|---|---|
| PubChem CID | 140594834 |
| Molecular Formula | C18H29ClN2O2 |
| Molecular Weight | 340.90 g/mol |
| Exact Mass | 340.19 |
| IUPAC Name | 2-amino-5-chloro-3-(2-cyclopropyl-5-methoxycyclohexyl)-3a,4,5,6,7,7a-hexahydroindol-3-ol |
| SMILES | COC1CCC(C2CC2)C(C2(O)C(N)=NC3CCC(Cl)CC32)C1 |
| InChI | InChI=1S/C18H29ClN2O2/c1-23-12-5-6-13(10-2-3-10)14(9-12)18(22)15-8-11(19)4-7-16(15)21-17(18)20/h10-16,22H,2-9H2,1H3,(H2,20,21) |
| InChIKey | XHXDZDFSFVIFGP-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 67.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.90 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|