C18H29ClN2O — CID 140594784
3-(1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-1-yl)-2-amino-5-chloro-3a,4,5,6,7,7a-hexahydroindol-3-ol (PubChem CID 140594784) has the molecular formula C18H29ClN2O and a molecular weight of 324.90 g/mol. Its IUPAC name is 3-(1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-1-yl)-2-amino-5-chloro-3a,4,5,6,7,7a-hexahydroindol-3-ol.
| Compound Name | 3-(1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-1-yl)-2-amino-5-chloro-3a,4,5,6,7,7a-hexahydroindol-3-ol |
|---|---|
| PubChem CID | 140594784 |
| Molecular Formula | C18H29ClN2O |
| Molecular Weight | 324.90 g/mol |
| Exact Mass | 324.20 |
| IUPAC Name | 3-(1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-1-yl)-2-amino-5-chloro-3a,4,5,6,7,7a-hexahydroindol-3-ol |
| SMILES | NC1=NC2CCC(Cl)CC2C1(O)C1CCCC2CCCCC21 |
| InChI | InChI=1S/C18H29ClN2O/c19-12-8-9-16-15(10-12)18(22,17(20)21-16)14-7-3-5-11-4-1-2-6-13(11)14/h11-16,22H,1-10H2,(H2,20,21) |
| InChIKey | SRFZFTZGKUAKER-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 58.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.90 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|