C17H27ClFN3O — CID 140594910
2-amino-5-chloro-3-(3-fluoro-1-methyl-2,3,3a,4,5,6,7,7a-octahydroindol-4-yl)-3a,4,5,6,7,7a-hexahydroindol-3-ol (PubChem CID 140594910) has the molecular formula C17H27ClFN3O and a molecular weight of 343.87 g/mol. Its IUPAC name is 2-amino-5-chloro-3-(3-fluoro-1-methyl-2,3,3a,4,5,6,7,7a-octahydroindol-4-yl)-3a,4,5,6,7,7a-hexahydroindol-3-ol.
| Compound Name | 2-amino-5-chloro-3-(3-fluoro-1-methyl-2,3,3a,4,5,6,7,7a-octahydroindol-4-yl)-3a,4,5,6,7,7a-hexahydroindol-3-ol |
|---|---|
| PubChem CID | 140594910 |
| Molecular Formula | C17H27ClFN3O |
| Molecular Weight | 343.87 g/mol |
| Exact Mass | 343.18 |
| IUPAC Name | 2-amino-5-chloro-3-(3-fluoro-1-methyl-2,3,3a,4,5,6,7,7a-octahydroindol-4-yl)-3a,4,5,6,7,7a-hexahydroindol-3-ol |
| SMILES | CN1CC(F)C2C1CCCC2C1(O)C(N)=NC2CCC(Cl)CC21 |
| InChI | InChI=1S/C17H27ClFN3O/c1-22-8-12(19)15-10(3-2-4-14(15)22)17(23)11-7-9(18)5-6-13(11)21-16(17)20/h9-15,23H,2-8H2,1H3,(H2,20,21) |
| InChIKey | JXZIMGGBUWTDMO-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 61.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.87 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|