C16H25ClN2O2 — CID 140594802
3-(2,3,3a,4,5,6,7,7a-octahydro-1-benzofuran-2-yl)-2-amino-5-chloro-3a,4,5,6,7,7a-hexahydroindol-3-ol (PubChem CID 140594802) has the molecular formula C16H25ClN2O2 and a molecular weight of 312.84 g/mol. Its IUPAC name is 3-(2,3,3a,4,5,6,7,7a-octahydro-1-benzofuran-2-yl)-2-amino-5-chloro-3a,4,5,6,7,7a-hexahydroindol-3-ol.
| Compound Name | 3-(2,3,3a,4,5,6,7,7a-octahydro-1-benzofuran-2-yl)-2-amino-5-chloro-3a,4,5,6,7,7a-hexahydroindol-3-ol |
|---|---|
| PubChem CID | 140594802 |
| Molecular Formula | C16H25ClN2O2 |
| Molecular Weight | 312.84 g/mol |
| Exact Mass | 312.16 |
| IUPAC Name | 3-(2,3,3a,4,5,6,7,7a-octahydro-1-benzofuran-2-yl)-2-amino-5-chloro-3a,4,5,6,7,7a-hexahydroindol-3-ol |
| SMILES | NC1=NC2CCC(Cl)CC2C1(O)C1CC2CCCCC2O1 |
| InChI | InChI=1S/C16H25ClN2O2/c17-10-5-6-12-11(8-10)16(20,15(18)19-12)14-7-9-3-1-2-4-13(9)21-14/h9-14,20H,1-8H2,(H2,18,19) |
| InChIKey | LDJYAQIBCSMNLP-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 67.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.84 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|