C16H27Cl2N3O — CID 140594940
2-amino-5-chloro-3-[5-chloro-2-(dimethylamino)cyclohexyl]-3a,4,5,6,7,7a-hexahydroindol-3-ol (PubChem CID 140594940) has the molecular formula C16H27Cl2N3O and a molecular weight of 348.32 g/mol. Its IUPAC name is 2-amino-5-chloro-3-[5-chloro-2-(dimethylamino)cyclohexyl]-3a,4,5,6,7,7a-hexahydroindol-3-ol.
| Compound Name | 2-amino-5-chloro-3-[5-chloro-2-(dimethylamino)cyclohexyl]-3a,4,5,6,7,7a-hexahydroindol-3-ol |
|---|---|
| PubChem CID | 140594940 |
| Molecular Formula | C16H27Cl2N3O |
| Molecular Weight | 348.32 g/mol |
| Exact Mass | 347.15 |
| IUPAC Name | 2-amino-5-chloro-3-[5-chloro-2-(dimethylamino)cyclohexyl]-3a,4,5,6,7,7a-hexahydroindol-3-ol |
| SMILES | CN(C)C1CCC(Cl)CC1C1(O)C(N)=NC2CCC(Cl)CC21 |
| InChI | InChI=1S/C16H27Cl2N3O/c1-21(2)14-6-4-10(18)8-12(14)16(22)11-7-9(17)3-5-13(11)20-15(16)19/h9-14,22H,3-8H2,1-2H3,(H2,19,20) |
| InChIKey | SLBCYESWSNZQFL-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 61.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.32 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|